![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 Car Hug.mp3 | 27-Aug-2007 19:40 | 3.5M | |
| 02 Rusted Shut.mp3 | 27-Aug-2007 19:31 | 9.1M | |
| 03 Crying Drunk Girls.mp3 | 27-Aug-2007 19:39 | 9.0M | |
| 05 The Relative Import of Being Shady.mp3 | 27-Aug-2007 19:19 | 2.1M | |
| 06 Strange Five Letter Label.mp3 | 27-Aug-2007 19:35 | 10M | |
| 07 Barre Chord Drug Stompp.mp3 | 27-Aug-2007 19:22 | 8.0M | |
| 08 Crazy + Dull.mp3 | 27-Aug-2007 19:43 | 5.5M | |
| 09 Unstable + Sick.mp3 | 27-Aug-2007 19:16 | 18M | |
| 11 More Dead Flowers.mp3 | 27-Aug-2007 19:08 | 11M | |
| 12 Epistola!.mp3 | 27-Aug-2007 19:18 | 5.5M | |
| 13 Boredom Beyond Comprehension.mp3 | 27-Aug-2007 19:27 | 9.6M | |